Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Rifamycin SV sodium salt, MP Biomedicals™
CAS: 14897-39-3 Molecular Formula: C37H47NNaO12 Molecular Weight (g/mol): 720.77 MDL Number: MFCD09752825 InChI Key: YVOFSHPIJOYKSH-DITFEXNXSA-N Synonym: rifamycin sodium salt,rifamycin sodium usan,rifamycin sv sodium salt,rifocina tn,otofa tn PubChem CID: 124219641 IUPAC Name: sodium (7S,9Z,11S,12R,13S,14R,15R,16R,17S,18S,19Z,21Z)-2,15,17,27,29-pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.1⁴,⁷.0⁵,²⁸]triaconta-1,3,5(28),9,19,21,25(29),26-octaen-13-yl acetate SMILES: [Na+].CO[C@H]1\C=C/O[C@@]2(C)OC3=C(C)C(O)=C4C(O)=C(NC(=O)\C(C)=C/C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C)C=C(O)C4=C3C2=O
| PubChem CID | 124219641 |
|---|---|
| CAS | 14897-39-3 |
| Molecular Weight (g/mol) | 720.77 |
| MDL Number | MFCD09752825 |
| SMILES | [Na+].CO[C@H]1\C=C/O[C@@]2(C)OC3=C(C)C(O)=C4C(O)=C(NC(=O)\C(C)=C/C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C)C=C(O)C4=C3C2=O |
| Synonym | rifamycin sodium salt,rifamycin sodium usan,rifamycin sv sodium salt,rifocina tn,otofa tn |
| IUPAC Name | sodium (7S,9Z,11S,12R,13S,14R,15R,16R,17S,18S,19Z,21Z)-2,15,17,27,29-pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.1⁴,⁷.0⁵,²⁸]triaconta-1,3,5(28),9,19,21,25(29),26-octaen-13-yl acetate |
| InChI Key | YVOFSHPIJOYKSH-DITFEXNXSA-N |
| Molecular Formula | C37H47NNaO12 |
Tetrakis(triphenylphosphine)palladium(0) 97.0+%, TCI America™
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: tetrakis(triphenylphosphane) palladium SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | tetrakis(triphenylphosphane) palladium |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
2,4-Dichlorophenol, 99%
CAS: 120-83-2 Molecular Formula: C6H4Cl2O Molecular Weight (g/mol): 163.00 MDL Number: MFCD00002169 InChI Key: HFZWRUODUSTPEG-UHFFFAOYSA-N Synonym: 4,6-dichlorophenol,phenol, 2,4-dichloro,2,4-dcp,2,4-dichloro-phenol,1-hydroxy-2,4-dichlorobenzene,rcra waste number u081,2,4-dichlorohydroxybenzene,ccris 657,rcra waste no. u081,1,3-dichloro-4-hydroxybenzene PubChem CID: 8449 ChEBI: CHEBI:16738 IUPAC Name: 2,4-dichlorophenol SMILES: OC1=CC=C(Cl)C=C1Cl
| PubChem CID | 8449 |
|---|---|
| CAS | 120-83-2 |
| Molecular Weight (g/mol) | 163.00 |
| ChEBI | CHEBI:16738 |
| MDL Number | MFCD00002169 |
| SMILES | OC1=CC=C(Cl)C=C1Cl |
| Synonym | 4,6-dichlorophenol,phenol, 2,4-dichloro,2,4-dcp,2,4-dichloro-phenol,1-hydroxy-2,4-dichlorobenzene,rcra waste number u081,2,4-dichlorohydroxybenzene,ccris 657,rcra waste no. u081,1,3-dichloro-4-hydroxybenzene |
| IUPAC Name | 2,4-dichlorophenol |
| InChI Key | HFZWRUODUSTPEG-UHFFFAOYSA-N |
| Molecular Formula | C6H4Cl2O |
| CAS | 3316-09-4 |
|---|---|
| ChEBI | CHEBI:16318 |
| MDL Number | MFCD00007242 |
6-Mercaptopurine monohydrate, 98%
CAS: 6112-76-1 Molecular Formula: C5H6N4OS Molecular Weight (g/mol): 170.19 MDL Number: MFCD03854445,MFCD01461928 InChI Key: WFFQYWAAEWLHJC-UHFFFAOYSA-N Synonym: 6-mercaptopurine monohydrate,6-mercaptopurine hydrate,mercaptopurine monohydrate,mercaptopurine hydrate,6h-purine-6-thione, 1,7-dihydro-, monohydrate,6,7-dihydro-3h-purine-6-thione hydrate,purine-6-thiol monohydrate,1,7-dihydro-6h-purine-6-thione monohydrate,purine-6-thiol, monohydrate,unii-e7wed276i5 PubChem CID: 2724350 ChEBI: CHEBI:31822 IUPAC Name: 3,7-dihydropurine-6-thione;hydrate SMILES: O.S=C1N=CNC2=C1NC=N2
| PubChem CID | 2724350 |
|---|---|
| CAS | 6112-76-1 |
| Molecular Weight (g/mol) | 170.19 |
| ChEBI | CHEBI:31822 |
| MDL Number | MFCD03854445,MFCD01461928 |
| SMILES | O.S=C1N=CNC2=C1NC=N2 |
| Synonym | 6-mercaptopurine monohydrate,6-mercaptopurine hydrate,mercaptopurine monohydrate,mercaptopurine hydrate,6h-purine-6-thione, 1,7-dihydro-, monohydrate,6,7-dihydro-3h-purine-6-thione hydrate,purine-6-thiol monohydrate,1,7-dihydro-6h-purine-6-thione monohydrate,purine-6-thiol, monohydrate,unii-e7wed276i5 |
| IUPAC Name | 3,7-dihydropurine-6-thione;hydrate |
| InChI Key | WFFQYWAAEWLHJC-UHFFFAOYSA-N |
| Molecular Formula | C5H6N4OS |
4-Bromo-1,2-dimethoxybenzene 97.0+%, TCI America™
CAS: 2859-78-1 Molecular Formula: C8H9BrO2 Molecular Weight (g/mol): 217.062 MDL Number: MFCD00008381 InChI Key: KBTMGSMZIKLAHN-UHFFFAOYSA-N Synonym: 4-bromoveratrole,1-bromo-3,4-dimethoxybenzene,3,4-dimethoxybromobenzene,p-bromoveratrole,benzene, 4-bromo-1,2-dimethoxy,3,4-dimethoxyphenyl bromide,4-bromo-1,2-dimethoxy-benzene,1,2-dimethoxy-4-bromobenzene,4-bromocatechol dimethyl ether,4-bromoveratrol PubChem CID: 76114 IUPAC Name: 4-bromo-1,2-dimethoxybenzene SMILES: COC1=C(C=C(C=C1)Br)OC
| PubChem CID | 76114 |
|---|---|
| CAS | 2859-78-1 |
| Molecular Weight (g/mol) | 217.062 |
| MDL Number | MFCD00008381 |
| SMILES | COC1=C(C=C(C=C1)Br)OC |
| Synonym | 4-bromoveratrole,1-bromo-3,4-dimethoxybenzene,3,4-dimethoxybromobenzene,p-bromoveratrole,benzene, 4-bromo-1,2-dimethoxy,3,4-dimethoxyphenyl bromide,4-bromo-1,2-dimethoxy-benzene,1,2-dimethoxy-4-bromobenzene,4-bromocatechol dimethyl ether,4-bromoveratrol |
| IUPAC Name | 4-bromo-1,2-dimethoxybenzene |
| InChI Key | KBTMGSMZIKLAHN-UHFFFAOYSA-N |
| Molecular Formula | C8H9BrO2 |
2,6-Dibromophenol, 99%
CAS: 608-33-3 Molecular Formula: C6H4Br2O Molecular Weight (g/mol): 251.91 MDL Number: MFCD00002152 InChI Key: SSIZLKDLDKIHEV-UHFFFAOYSA-N Synonym: phenol, 2,6-dibromo,2,6-dibromo-phenol,unii-27mip05eav,2,6-dibromo-pheno,27mip05eav,2,6-bis bromanyl phenol,acmc-1au9i,2,6-dibromophenol,ksc493e5t,2,6-dibromophenol, analytical standard PubChem CID: 11847 ChEBI: CHEBI:19391 IUPAC Name: 2,6-dibromophenol SMILES: OC1=C(Br)C=CC=C1Br
| PubChem CID | 11847 |
|---|---|
| CAS | 608-33-3 |
| Molecular Weight (g/mol) | 251.91 |
| ChEBI | CHEBI:19391 |
| MDL Number | MFCD00002152 |
| SMILES | OC1=C(Br)C=CC=C1Br |
| Synonym | phenol, 2,6-dibromo,2,6-dibromo-phenol,unii-27mip05eav,2,6-dibromo-pheno,27mip05eav,2,6-bis bromanyl phenol,acmc-1au9i,2,6-dibromophenol,ksc493e5t,2,6-dibromophenol, analytical standard |
| IUPAC Name | 2,6-dibromophenol |
| InChI Key | SSIZLKDLDKIHEV-UHFFFAOYSA-N |
| Molecular Formula | C6H4Br2O |
Benzyltriethylammonium chloride, 98%
CAS: 56-37-1 Molecular Formula: C13H22ClN Molecular Weight (g/mol): 227.78 MDL Number: MFCD00011824 InChI Key: HTZCNXWZYVXIMZ-UHFFFAOYSA-M Synonym: benzyltriethylammonium chloride,tebac,benzyl triethylammonium chloride,benzyl triethyl ammonium chloride,benzyltriethylammoniumchloride,triethylbenzylammonium chloride,bteac,teba,benzyltriethylazanium chloride,n-benzyl-n,n-diethylethanaminium chloride PubChem CID: 66133 IUPAC Name: benzyl(triethyl)azanium;chloride SMILES: [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1
| PubChem CID | 66133 |
|---|---|
| CAS | 56-37-1 |
| Molecular Weight (g/mol) | 227.78 |
| MDL Number | MFCD00011824 |
| SMILES | [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 |
| Synonym | benzyltriethylammonium chloride,tebac,benzyl triethylammonium chloride,benzyl triethyl ammonium chloride,benzyltriethylammoniumchloride,triethylbenzylammonium chloride,bteac,teba,benzyltriethylazanium chloride,n-benzyl-n,n-diethylethanaminium chloride |
| IUPAC Name | benzyl(triethyl)azanium;chloride |
| InChI Key | HTZCNXWZYVXIMZ-UHFFFAOYSA-M |
| Molecular Formula | C13H22ClN |
3-Methyl-1-phenyl-2-pyrazolin-5-one, 99%
CAS: 89-25-8 Molecular Formula: C10H10N2O Molecular Weight (g/mol): 174.2 MDL Number: MFCD00003138 InChI Key: QELUYTUMUWHWMC-UHFFFAOYSA-N Synonym: edaravone,3-methyl-1-phenyl-2-pyrazolin-5-one,norphenazone,radicut,1-phenyl-3-methyl-5-pyrazolone,developer z,methylphenylpyrazolone,norantipyrine,c.i. developer 1,phenylmethylpyrazolone PubChem CID: 4021 ChEBI: CHEBI:31530 IUPAC Name: 5-methyl-2-phenyl-4H-pyrazol-3-one SMILES: CC1=NN(C(=O)C1)C2=CC=CC=C2
| PubChem CID | 4021 |
|---|---|
| CAS | 89-25-8 |
| Molecular Weight (g/mol) | 174.2 |
| ChEBI | CHEBI:31530 |
| MDL Number | MFCD00003138 |
| SMILES | CC1=NN(C(=O)C1)C2=CC=CC=C2 |
| Synonym | edaravone,3-methyl-1-phenyl-2-pyrazolin-5-one,norphenazone,radicut,1-phenyl-3-methyl-5-pyrazolone,developer z,methylphenylpyrazolone,norantipyrine,c.i. developer 1,phenylmethylpyrazolone |
| IUPAC Name | 5-methyl-2-phenyl-4H-pyrazol-3-one |
| InChI Key | QELUYTUMUWHWMC-UHFFFAOYSA-N |
| Molecular Formula | C10H10N2O |
Nimesulide
CAS: 51803-78-2 Molecular Formula: C13H12N2O5S Molecular Weight (g/mol): 308.308 MDL Number: MFCD00079470 InChI Key: HYWYRSMBCFDLJT-UHFFFAOYSA-N Synonym: nimesulide,mesulid,n-4-nitro-2-phenoxyphenyl methanesulfonamide,flogovital,sulidene,nimed,4-nitro-2-phenoxymethanesulfonanilide,nisulid,nimesulidum inn-latin,nimesulida inn-spanish PubChem CID: 4495 ChEBI: CHEBI:44445 IUPAC Name: N-(4-nitro-2-phenoxyphenyl)methanesulfonamide SMILES: CS(=O)(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])OC2=CC=CC=C2
| PubChem CID | 4495 |
|---|---|
| CAS | 51803-78-2 |
| Molecular Weight (g/mol) | 308.308 |
| ChEBI | CHEBI:44445 |
| MDL Number | MFCD00079470 |
| SMILES | CS(=O)(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])OC2=CC=CC=C2 |
| Synonym | nimesulide,mesulid,n-4-nitro-2-phenoxyphenyl methanesulfonamide,flogovital,sulidene,nimed,4-nitro-2-phenoxymethanesulfonanilide,nisulid,nimesulidum inn-latin,nimesulida inn-spanish |
| IUPAC Name | N-(4-nitro-2-phenoxyphenyl)methanesulfonamide |
| InChI Key | HYWYRSMBCFDLJT-UHFFFAOYSA-N |
| Molecular Formula | C13H12N2O5S |
Isobutyl chloroformate, 98%
CAS: 543-27-1 Molecular Formula: C5H9ClO2 Molecular Weight (g/mol): 136.58 MDL Number: MFCD00000642 InChI Key: YOETUEMZNOLGDB-UHFFFAOYSA-N Synonym: isobutyl chloroformate,2-methylpropyl chloroformate,chloroformic acid isobutyl ester,isobutyl chlorocarbonate,carbonochloridic acid, 2-methylpropyl ester,isobutylchloroformate,i-butyl chloroformate,chlorocarbonic acid isobutyl ester,isobutyl carbonochloridate,unii-6s785tc0ob PubChem CID: 62365 IUPAC Name: 2-methylpropyl carbonochloridate SMILES: CC(C)COC(=O)Cl
| PubChem CID | 62365 |
|---|---|
| CAS | 543-27-1 |
| Molecular Weight (g/mol) | 136.58 |
| MDL Number | MFCD00000642 |
| SMILES | CC(C)COC(=O)Cl |
| Synonym | isobutyl chloroformate,2-methylpropyl chloroformate,chloroformic acid isobutyl ester,isobutyl chlorocarbonate,carbonochloridic acid, 2-methylpropyl ester,isobutylchloroformate,i-butyl chloroformate,chlorocarbonic acid isobutyl ester,isobutyl carbonochloridate,unii-6s785tc0ob |
| IUPAC Name | 2-methylpropyl carbonochloridate |
| InChI Key | YOETUEMZNOLGDB-UHFFFAOYSA-N |
| Molecular Formula | C5H9ClO2 |
n-Butyl acetate, 99+%
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Adenine Sulfate Dihydrate, >97%
CAS: 321-30-2 Molecular Formula: C10H12N10O4S Molecular Weight (g/mol): 368.33 MDL Number: MFCD00213655 InChI Key: LQXHSCOPYJCOMD-UHFFFAOYSA-N Synonym: adenine sulfate,adenine hemisulfate,7 h-purin-6-amine sulfate 2:1,adeninsulfat,adeninium sulfate,adenine sulfate 2:1,adeninsulfat german,1h-purin-6-amine, sulfate 2:1,diadenine sulphate,unii-741gjf3k9m PubChem CID: 9449 IUPAC Name: 7 H-purin-6-amine;sulfuric acid SMILES: OS(O)(=O)=O.NC1=C2NC=NC2=NC=N1.NC1=C2NC=NC2=NC=N1
| PubChem CID | 9449 |
|---|---|
| CAS | 321-30-2 |
| Molecular Weight (g/mol) | 368.33 |
| MDL Number | MFCD00213655 |
| SMILES | OS(O)(=O)=O.NC1=C2NC=NC2=NC=N1.NC1=C2NC=NC2=NC=N1 |
| Synonym | adenine sulfate,adenine hemisulfate,7 h-purin-6-amine sulfate 2:1,adeninsulfat,adeninium sulfate,adenine sulfate 2:1,adeninsulfat german,1h-purin-6-amine, sulfate 2:1,diadenine sulphate,unii-741gjf3k9m |
| IUPAC Name | 7 H-purin-6-amine;sulfuric acid |
| InChI Key | LQXHSCOPYJCOMD-UHFFFAOYSA-N |
| Molecular Formula | C10H12N10O4S |
n-Propyl 4-hydroxybenzoate, 99+%
CAS: 94-13-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00002354 InChI Key: QELSKZZBTMNZEB-UHFFFAOYSA-N Synonym: propylparaben,propyl paraben,4-hydroxybenzoic acid propyl ester,propyl p-hydroxybenzoate,nipasol,nipazol,propyl butex,betacide p,propyl parahydroxybenzoate,propylparasept PubChem CID: 7175 ChEBI: CHEBI:32063 IUPAC Name: propyl 4-hydroxybenzoate SMILES: CCCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7175 |
|---|---|
| CAS | 94-13-3 |
| Molecular Weight (g/mol) | 180.203 |
| ChEBI | CHEBI:32063 |
| MDL Number | MFCD00002354 |
| SMILES | CCCOC(=O)C1=CC=C(C=C1)O |
| Synonym | propylparaben,propyl paraben,4-hydroxybenzoic acid propyl ester,propyl p-hydroxybenzoate,nipasol,nipazol,propyl butex,betacide p,propyl parahydroxybenzoate,propylparasept |
| IUPAC Name | propyl 4-hydroxybenzoate |
| InChI Key | QELSKZZBTMNZEB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
4-(Methylamino)benzoic acid, 97%
CAS: 10541-83-0 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.165 MDL Number: MFCD00002535 InChI Key: ZVIDMSBTYRSMAR-UHFFFAOYSA-N Synonym: 4-methylamino benzoic acid,benzoic acid, 4-methylamino,p-methylaminobenzoic acid,n-methyl-4-aminobenzoic acid,4-n-methylamino benzoic acid,n-methyl-4-aminobenzoate,benzoic acid, p-methylamino,4-methylamino-benzoic acid,p-methylamino benzoic acid,p-n-methylamino benzoic acid PubChem CID: 66345 ChEBI: CHEBI:7308 IUPAC Name: 4-(methylamino)benzoic acid SMILES: CNC1=CC=C(C=C1)C(=O)O
| PubChem CID | 66345 |
|---|---|
| CAS | 10541-83-0 |
| Molecular Weight (g/mol) | 151.165 |
| ChEBI | CHEBI:7308 |
| MDL Number | MFCD00002535 |
| SMILES | CNC1=CC=C(C=C1)C(=O)O |
| Synonym | 4-methylamino benzoic acid,benzoic acid, 4-methylamino,p-methylaminobenzoic acid,n-methyl-4-aminobenzoic acid,4-n-methylamino benzoic acid,n-methyl-4-aminobenzoate,benzoic acid, p-methylamino,4-methylamino-benzoic acid,p-methylamino benzoic acid,p-n-methylamino benzoic acid |
| IUPAC Name | 4-(methylamino)benzoic acid |
| InChI Key | ZVIDMSBTYRSMAR-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |